C26H37N3O5S — CID 100542387
(2S)-2-[benzyl-[4-(2-methoxy-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide (PubChem CID 100542387) has the molecular formula C26H37N3O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is (2S)-2-[benzyl-[4-(2-methoxy-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide.
| Compound Name | (2S)-2-[benzyl-[4-(2-methoxy-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100542387 |
| Molecular Formula | C26H37N3O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (2S)-2-[benzyl-[4-(2-methoxy-N-methylsulfonylanilino)butanoyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@H](CC)N(Cc1ccccc1)C(=O)CCCN(c1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C26H37N3O5S/c1-5-18-27-26(31)22(6-2)28(20-21-13-8-7-9-14-21)25(30)17-12-19-29(35(4,32)33)23-15-10-11-16-24(23)34-3/h7-11,13-16,22H,5-6,12,17-20H2,1-4H3,(H,27,31)/t22-/m0/s1 |
| InChIKey | FRETVHWAOHYVGH-QFIPXVFZSA-N |
| XLogP | 3.58 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |