C27H39N3O4S — CID 132725700
2-[benzyl-[4-(2-methyl-N-methylsulfonylanilino)butanoyl]amino]-N-butylbutanamide (PubChem CID 132725700) has the molecular formula C27H39N3O4S and a molecular weight of 501.69 g/mol. Its IUPAC name is 2-[benzyl-[4-(2-methyl-N-methylsulfonylanilino)butanoyl]amino]-N-butylbutanamide.
| Compound Name | 2-[benzyl-[4-(2-methyl-N-methylsulfonylanilino)butanoyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132725700 |
| Molecular Formula | C27H39N3O4S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-[benzyl-[4-(2-methyl-N-methylsulfonylanilino)butanoyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CCCN(c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C27H39N3O4S/c1-5-7-19-28-27(32)24(6-2)29(21-23-15-9-8-10-16-23)26(31)18-13-20-30(35(4,33)34)25-17-12-11-14-22(25)3/h8-12,14-17,24H,5-7,13,18-21H2,1-4H3,(H,28,32) |
| InChIKey | JXIGZPVKFWCBKR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|