C27H39N3O4S — CID 132725814
N-benzyl-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 132725814) has the molecular formula C27H39N3O4S and a molecular weight of 501.69 g/mol. Its IUPAC name is N-benzyl-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-benzyl-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 132725814 |
| Molecular Formula | C27H39N3O4S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N-benzyl-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1)C(=O)CCCN(c1cccc(C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C27H39N3O4S/c1-6-7-18-28-27(32)23(4)29(20-24-14-9-8-10-15-24)26(31)17-12-19-30(35(5,33)34)25-16-11-13-21(2)22(25)3/h8-11,13-16,23H,6-7,12,17-20H2,1-5H3,(H,28,32) |
| InChIKey | VWVNPRUKOORRJU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|