C29H43N3O4S — CID 132733517
N-butyl-2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 132733517) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is N-butyl-2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132733517 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | N-butyl-2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1C)C(=O)CCCN(c1cc(C)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C29H43N3O4S/c1-7-9-18-30-29(34)26(8-2)31(21-25-14-11-10-13-23(25)4)28(33)15-12-19-32(37(6,35)36)27-20-22(3)16-17-24(27)5/h10-11,13-14,16-17,20,26H,7-9,12,15,18-19,21H2,1-6H3,(H,30,34) |
| InChIKey | RFQSIPMVKWVPJG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|