C27H37F2N3O4S — CID 132735467
N-butyl-2-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 132735467) has the molecular formula C27H37F2N3O4S and a molecular weight of 537.67 g/mol. Its IUPAC name is N-butyl-2-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132735467 |
| Molecular Formula | C27H37F2N3O4S |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | N-butyl-2-[4-(3,4-difluoro-N-methylsulfonylanilino)butanoyl-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1C)C(=O)CCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H37F2N3O4S/c1-5-7-16-30-27(34)25(6-2)31(19-21-12-9-8-11-20(21)3)26(33)13-10-17-32(37(4,35)36)22-14-15-23(28)24(29)18-22/h8-9,11-12,14-15,18,25H,5-7,10,13,16-17,19H2,1-4H3,(H,30,34) |
| InChIKey | HRPHVDUKZUQDNL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|