C31H35Cl2F2N3O4S — CID 100687969
N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide (PubChem CID 100687969) has the molecular formula C31H35Cl2F2N3O4S and a molecular weight of 654.61 g/mol. Its IUPAC name is N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100687969 |
| Molecular Formula | C31H35Cl2F2N3O4S |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(3,4-difluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C31H35Cl2F2N3O4S/c1-3-4-16-36-31(40)29(18-22-9-6-5-7-10-22)37(21-23-12-13-24(32)19-26(23)33)30(39)11-8-17-38(43(2,41)42)25-14-15-27(34)28(35)20-25/h5-7,9-10,12-15,19-20,29H,3-4,8,11,16-18,21H2,1-2H3,(H,36,40)/t29-/m1/s1 |
| InChIKey | NAOIPSQMTQZPOO-GDLZYMKVSA-N |
| XLogP | 6.37 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|