C33H41Cl2N3O4S — CID 133206886
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(2,5-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 133206886) has the molecular formula C33H41Cl2N3O4S and a molecular weight of 646.68 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(2,5-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(2,5-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133206886 |
| Molecular Formula | C33H41Cl2N3O4S |
| Molecular Weight | 646.68 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]-4-(2,5-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCN(c1cc(C)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C33H41Cl2N3O4S/c1-5-6-18-36-33(40)31(21-26-11-8-7-9-12-26)37(23-27-16-17-28(34)22-29(27)35)32(39)13-10-19-38(43(4,41)42)30-20-24(2)14-15-25(30)3/h7-9,11-12,14-17,20,22,31H,5-6,10,13,18-19,21,23H2,1-4H3,(H,36,40) |
| InChIKey | GDAJYTHZGJETLL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|