C31H37ClFN3O4S — CID 100651000
N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chloro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 100651000) has the molecular formula C31H37ClFN3O4S and a molecular weight of 602.17 g/mol. Its IUPAC name is N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chloro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chloro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100651000 |
| Molecular Formula | C31H37ClFN3O4S |
| Molecular Weight | 602.17 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chloro-N-methylsulfonylanilino)-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCCN(c1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C31H37ClFN3O4S/c1-3-4-20-34-31(38)29(22-24-11-6-5-7-12-24)35(23-25-13-8-9-14-28(25)33)30(37)15-10-21-36(41(2,39)40)27-18-16-26(32)17-19-27/h5-9,11-14,16-19,29H,3-4,10,15,20-23H2,1-2H3,(H,34,38)/t29-/m1/s1 |
| InChIKey | KGWLHIXUCREOKK-GDLZYMKVSA-N |
| XLogP | 5.58 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.17 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|