C31H36Cl2FN3O4S — CID 133207232
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide (PubChem CID 133207232) has the molecular formula C31H36Cl2FN3O4S and a molecular weight of 636.62 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133207232 |
| Molecular Formula | C31H36Cl2FN3O4S |
| Molecular Weight | 636.62 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCN(c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C31H36Cl2FN3O4S/c1-3-4-18-35-31(39)29(21-23-9-6-5-7-10-23)36(22-24-12-17-27(32)28(33)20-24)30(38)11-8-19-37(42(2,40)41)26-15-13-25(34)14-16-26/h5-7,9-10,12-17,20,29H,3-4,8,11,18-19,21-22H2,1-2H3,(H,35,39) |
| InChIKey | KCRGFBCJDRXFJY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|