C32H39Cl2N3O5S — CID 133207293
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 133207293) has the molecular formula C32H39Cl2N3O5S and a molecular weight of 648.65 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133207293 |
| Molecular Formula | C32H39Cl2N3O5S |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCN(c1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C32H39Cl2N3O5S/c1-4-5-19-35-32(39)29(22-24-12-7-6-8-13-24)36(23-25-17-18-26(33)27(34)21-25)31(38)16-11-20-37(43(3,40)41)28-14-9-10-15-30(28)42-2/h6-10,12-15,17-18,21,29H,4-5,11,16,19-20,22-23H2,1-3H3,(H,35,39) |
| InChIKey | FTZCPVMKWOHPEF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|