C33H42ClN3O5S — CID 100614941
N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100614941) has the molecular formula C33H42ClN3O5S and a molecular weight of 628.24 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100614941 |
| Molecular Formula | C33H42ClN3O5S |
| Molecular Weight | 628.24 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-chlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CCCN(c1ccccc1OCC)S(C)(=O)=O |
| InChI | InChI=1S/C33H42ClN3O5S/c1-4-6-22-35-33(39)30(24-26-15-8-7-9-16-26)36(25-27-17-10-11-18-28(27)34)32(38)21-14-23-37(43(3,40)41)29-19-12-13-20-31(29)42-5-2/h7-13,15-20,30H,4-6,14,21-25H2,1-3H3,(H,35,39)/t30-/m0/s1 |
| InChIKey | WBYCCGFLMNBLSV-PMERELPUSA-N |
| XLogP | 5.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.24 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|