C33H41Cl2N3O5S — CID 133204461
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide (PubChem CID 133204461) has the molecular formula C33H41Cl2N3O5S and a molecular weight of 662.68 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133204461 |
| Molecular Formula | C33H41Cl2N3O5S |
| Molecular Weight | 662.68 g/mol |
| Exact Mass | 661.21 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(2-ethoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCCN(c1ccccc1OCC)S(C)(=O)=O |
| InChI | InChI=1S/C33H41Cl2N3O5S/c1-4-6-21-36-33(40)30(23-25-14-8-7-9-15-25)37(24-26-27(34)16-12-17-28(26)35)32(39)20-13-22-38(44(3,41)42)29-18-10-11-19-31(29)43-5-2/h7-12,14-19,30H,4-6,13,20-24H2,1-3H3,(H,36,40) |
| InChIKey | CENZXHGMQYJVBY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|