C32H40FN3O5S — CID 133232037
N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 133232037) has the molecular formula C32H40FN3O5S and a molecular weight of 597.75 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133232037 |
| Molecular Formula | C32H40FN3O5S |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCCN(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C32H40FN3O5S/c1-4-5-20-34-32(38)30(22-25-13-7-6-8-14-25)35(24-26-15-9-10-18-29(26)33)31(37)19-12-21-36(42(3,39)40)27-16-11-17-28(23-27)41-2/h6-11,13-18,23,30H,4-5,12,19-22,24H2,1-3H3,(H,34,38) |
| InChIKey | OWJCATRNXMGKJP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|