C20H22N2O2S — CID 100545172
N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide (PubChem CID 100545172) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide.
| Compound Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 100545172 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(CCC(=O)Nc2ccc3c(c2)sc(=O)n3CC)cc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-14-5-7-15(8-6-14)9-12-19(23)21-16-10-11-17-18(13-16)25-20(24)22(17)4-2/h5-8,10-11,13H,3-4,9,12H2,1-2H3,(H,21,23) |
| InChIKey | IUPKYCFIKCFBQD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |