C16H14FN3OS2 — CID 100548674
1-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)thiourea (PubChem CID 100548674) has the molecular formula C16H14FN3OS2 and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100548674 |
| Molecular Formula | C16H14FN3OS2 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)thiourea |
| SMILES | CCn1c(=O)sc2cc(NC(=S)Nc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H14FN3OS2/c1-2-20-13-8-7-12(9-14(13)23-16(20)21)19-15(22)18-11-5-3-10(17)4-6-11/h3-9H,2H2,1H3,(H2,18,19,22) |
| InChIKey | YHWOJAUCQCBIHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|