C24H29NO4 — CID 100545801
N-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide (PubChem CID 100545801) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide.
| Compound Name | N-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
|---|---|
| PubChem CID | 100545801 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
| SMILES | COc1ccc2c(c1)OC(C)(C)C[C@@H]2NC(=O)COc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H29NO4/c1-24(2)14-20(19-12-11-17(27-3)13-22(19)29-24)25-23(26)15-28-21-10-6-8-16-7-4-5-9-18(16)21/h6,8,10-13,20H,4-5,7,9,14-15H2,1-3H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | YQQBGQLEKPKYBN-FQEVSTJZSA-N |
| XLogP | 4.37 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |