C23H27NO3 — CID 100670206
N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide (PubChem CID 100670206) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide.
| Compound Name | N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
|---|---|
| PubChem CID | 100670206 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetamide |
| SMILES | CC1(C)C[C@H](NC(=O)COc2cccc3c2CCCC3)c2ccccc2O1 |
| InChI | InChI=1S/C23H27NO3/c1-23(2)14-19(18-11-5-6-12-21(18)27-23)24-22(25)15-26-20-13-7-9-16-8-3-4-10-17(16)20/h5-7,9,11-13,19H,3-4,8,10,14-15H2,1-2H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | FSGXKMBZPQNQDH-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |