C26H39N5O13 — CID 10054751
2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid (PubChem CID 10054751) has the molecular formula C26H39N5O13 and a molecular weight of 629.62 g/mol. Its IUPAC name is 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid.
| Compound Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 10054751 |
| Molecular Formula | C26H39N5O13 |
| Molecular Weight | 629.62 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]-6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoic acid |
| SMILES | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)C(CCCCNC(=O)CCCN1C(=O)C=CC1=O)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C26H39N5O13/c32-19(5-3-9-31-20(33)6-7-21(31)34)27-8-2-1-4-18(26(43)44)30(12-10-28(14-22(35)36)15-23(37)38)13-11-29(16-24(39)40)17-25(41)42/h6-7,18H,1-5,8-17H2,(H,27,32)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | CSTLTHSUTNSFMB-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 262.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.62 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|