C14H18F3N3O7 — CID 175290419
(2R)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 175290419) has the molecular formula C14H18F3N3O7 and a molecular weight of 397.31 g/mol. Its IUPAC name is (2R)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175290419 |
| Molecular Formula | C14H18F3N3O7 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2R)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC[C@@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O5.C2HF3O2/c13-6-2-1-3-8(12(19)20)14-9(16)7-15-10(17)4-5-11(15)18;3-2(4,5)1(6)7/h4-5,8H,1-3,6-7,13H2,(H,14,16)(H,19,20);(H,6,7)/t8-;/m1./s1 |
| InChIKey | PZLLPVDSNJVCOS-DDWIOCJRSA-N |
| XLogP | -0.76 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|