C16H23F3N2O4 — CID 130227293
2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoic acid (PubChem CID 130227293) has the molecular formula C16H23F3N2O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 130227293 |
| Molecular Formula | C16H23F3N2O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(CCCCCN1C(=O)C=CC1=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H23F3N2O4/c1-10(2)14(15(24)25)20-11(16(17,18)19)6-4-3-5-9-21-12(22)7-8-13(21)23/h7-8,10-11,14,20H,3-6,9H2,1-2H3,(H,24,25) |
| InChIKey | IXSCJZVRYZGHND-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|