C36H68O5Si2 — CID 10054873
(1R,2E)-1-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-3-[tri(propan-2-yl)silyloxymethyl]penta-2,4-dien-1-ol (PubChem CID 10054873) has the molecular formula C36H68O5Si2 and a molecular weight of 637.11 g/mol. Its IUPAC name is (1R,2E)-1-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-3-[tri(propan-2-yl)silyloxymethyl]penta-2,4-dien-1-ol.
| Compound Name | (1R,2E)-1-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-3-[tri(propan-2-yl)silyloxymethyl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10054873 |
| Molecular Formula | C36H68O5Si2 |
| Molecular Weight | 637.11 g/mol |
| Exact Mass | 636.46 |
| IUPAC Name | (1R,2E)-1-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-3-[tri(propan-2-yl)silyloxymethyl]penta-2,4-dien-1-ol |
| SMILES | C=C/C(=C\[C@@H](O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)=C(C2OCC(C)(C)CO2)C1(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H68O5Si2/c1-18-28(21-40-43(24(2)3,25(4)5)26(6)7)19-30(37)29-20-31(41-42(16,17)34(9,10)11)27(8)32(36(29,14)15)33-38-22-35(12,13)23-39-33/h18-19,24-26,29-31,33,37H,1,20-23H2,2-17H3/b28-19+/t29-,30+,31+/m0/s1 |
| InChIKey | CUXZRMODELGYLL-ZKXNMWCLSA-N |
| XLogP | 9.80 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.11 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|