C24H20N2O4S — CID 100554084
1-(cyclopropanecarbonyl)-N-dibenzofuran-3-yl-2,3-dihydroindole-5-sulfonamide (PubChem CID 100554084) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-dibenzofuran-3-yl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-dibenzofuran-3-yl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 100554084 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-dibenzofuran-3-yl-2,3-dihydroindole-5-sulfonamide |
| SMILES | O=C(C1CC1)N1CCc2cc(S(=O)(=O)Nc3ccc4c(c3)oc3ccccc34)ccc21 |
| InChI | InChI=1S/C24H20N2O4S/c27-24(15-5-6-15)26-12-11-16-13-18(8-10-21(16)26)31(28,29)25-17-7-9-20-19-3-1-2-4-22(19)30-23(20)14-17/h1-4,7-10,13-15,25H,5-6,11-12H2 |
| InChIKey | NHZSOSIDXTYAAX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |