C19H19BrN2O3S — CID 20853260
N-(4-bromophenyl)-1-(cyclobutanecarbonyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 20853260) has the molecular formula C19H19BrN2O3S and a molecular weight of 435.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(cyclobutanecarbonyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(4-bromophenyl)-1-(cyclobutanecarbonyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20853260 |
| Molecular Formula | C19H19BrN2O3S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-(4-bromophenyl)-1-(cyclobutanecarbonyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | O=C(C1CCC1)N1CCc2cc(S(=O)(=O)Nc3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C19H19BrN2O3S/c20-15-4-6-16(7-5-15)21-26(24,25)17-8-9-18-14(12-17)10-11-22(18)19(23)13-2-1-3-13/h4-9,12-13,21H,1-3,10-11H2 |
| InChIKey | YLPKPMWJJBLFAC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |