C27H28ClN3O3 — CID 100554651
(2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide (PubChem CID 100554651) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100554651 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Cl)c1)C(=O)CN1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C27H28ClN3O3/c1-3-4-14-29-26(33)18(2)30(16-19-8-5-11-21(28)15-19)24(32)17-31-23-13-7-10-20-9-6-12-22(25(20)23)27(31)34/h5-13,15,18H,3-4,14,16-17H2,1-2H3,(H,29,33)/t18-/m1/s1 |
| InChIKey | OEYXFCYCKPZTBY-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|