C27H27Cl2N3O3 — CID 132728951
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide (PubChem CID 132728951) has the molecular formula C27H27Cl2N3O3 and a molecular weight of 512.44 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132728951 |
| Molecular Formula | C27H27Cl2N3O3 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C27H27Cl2N3O3/c1-3-4-13-30-26(34)17(2)31(15-18-11-12-21(28)22(29)14-18)24(33)16-32-23-10-6-8-19-7-5-9-20(25(19)23)27(32)35/h5-12,14,17H,3-4,13,15-16H2,1-2H3,(H,30,34) |
| InChIKey | BFOVABHWQFDJJW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|