C25H19ClN4O9 — CID 100556284
(3S,3aR,6aR)-5-(4-chlorophenyl)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 100556284) has the molecular formula C25H19ClN4O9 and a molecular weight of 554.90 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(4-chlorophenyl)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-5-(4-chlorophenyl)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 100556284 |
| Molecular Formula | C25H19ClN4O9 |
| Molecular Weight | 554.90 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | (3S,3aR,6aR)-5-(4-chlorophenyl)-3-(4,5-dimethoxy-2-nitrophenyl)-2-(3-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1cc([C@@H]2[C@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]3ON2c2cccc([N+](=O)[O-])c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H19ClN4O9/c1-37-19-11-17(18(30(35)36)12-20(19)38-2)22-21-23(39-28(22)15-4-3-5-16(10-15)29(33)34)25(32)27(24(21)31)14-8-6-13(26)7-9-14/h3-12,21-23H,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | FAQNPEIKAMSWSM-DNVJHFABSA-N |
| XLogP | 4.22 |
| TPSA | 154.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|