C26H22ClN3O8 — CID 100823594
(3S,3aS,6aR)-5-(3-chlorophenyl)-2-(3-nitrophenyl)-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 100823594) has the molecular formula C26H22ClN3O8 and a molecular weight of 539.93 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-(3-chlorophenyl)-2-(3-nitrophenyl)-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aR)-5-(3-chlorophenyl)-2-(3-nitrophenyl)-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 100823594 |
| Molecular Formula | C26H22ClN3O8 |
| Molecular Weight | 539.93 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | (3S,3aS,6aR)-5-(3-chlorophenyl)-2-(3-nitrophenyl)-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2[C@@H]3C(=O)N(c4cccc(Cl)c4)C(=O)[C@@H]3ON2c2cccc([N+](=O)[O-])c2)c(OC)c1OC |
| InChI | InChI=1S/C26H22ClN3O8/c1-35-19-11-10-18(22(36-2)23(19)37-3)21-20-24(38-29(21)16-8-5-9-17(13-16)30(33)34)26(32)28(25(20)31)15-7-4-6-14(27)12-15/h4-13,20-21,24H,1-3H3/t20-,21+,24+/m0/s1 |
| InChIKey | JKHDSYGWXDPJOK-YZUZCNPQSA-N |
| XLogP | 4.33 |
| TPSA | 120.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|