C26H23FN2O6 — CID 3588565
5-(3-fluorophenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3588565) has the molecular formula C26H23FN2O6 and a molecular weight of 478.48 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(3-fluorophenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3588565 |
| Molecular Formula | C26H23FN2O6 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 5-(3-fluorophenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc(C2C3C(=O)N(c4cccc(F)c4)C(=O)C3ON2c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C26H23FN2O6/c1-32-19-13-12-18(22(33-2)23(19)34-3)21-20-24(35-29(21)16-9-5-4-6-10-16)26(31)28(25(20)30)17-11-7-8-15(27)14-17/h4-14,20-21,24H,1-3H3 |
| InChIKey | NSOLINBOXUOZHN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|