C30H32N2O7 — CID 124773692
(3S,3aR,6aR)-5-(4-butoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 124773692) has the molecular formula C30H32N2O7 and a molecular weight of 532.59 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(4-butoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-5-(4-butoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 124773692 |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (3S,3aR,6aR)-5-(4-butoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCCOc1ccc(N2C(=O)[C@@H]3[C@@H](c4ccc(OC)c(OC)c4OC)N(c4ccccc4)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C30H32N2O7/c1-5-6-18-38-21-14-12-19(13-15-21)31-29(33)24-25(22-16-17-23(35-2)27(37-4)26(22)36-3)32(39-28(24)30(31)34)20-10-8-7-9-11-20/h7-17,24-25,28H,5-6,18H2,1-4H3/t24-,25-,28-/m1/s1 |
| InChIKey | LMTASRWXQJSKHM-INNMJMHTSA-N |
| XLogP | 4.94 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|