C28H28N2O7 — CID 124774090
(3S,3aR,6aR)-5-(3-ethoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 124774090) has the molecular formula C28H28N2O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is (3S,3aR,6aR)-5-(3-ethoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-5-(3-ethoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 124774090 |
| Molecular Formula | C28H28N2O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (3S,3aR,6aR)-5-(3-ethoxyphenyl)-2-phenyl-3-(2,3,4-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cccc(N2C(=O)[C@@H]3[C@@H](c4ccc(OC)c(OC)c4OC)N(c4ccccc4)O[C@H]3C2=O)c1 |
| InChI | InChI=1S/C28H28N2O7/c1-5-36-19-13-9-12-18(16-19)29-27(31)22-23(20-14-15-21(33-2)25(35-4)24(20)34-3)30(37-26(22)28(29)32)17-10-7-6-8-11-17/h6-16,22-23,26H,5H2,1-4H3/t22-,23-,26-/m1/s1 |
| InChIKey | WMXVNNCFPVXEDE-JQYIIUTOSA-N |
| XLogP | 4.16 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|