C15H11Cl2N3O2S3 — CID 100557354
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide (PubChem CID 100557354) has the molecular formula C15H11Cl2N3O2S3 and a molecular weight of 432.38 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 100557354 |
| Molecular Formula | C15H11Cl2N3O2S3 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nnc(SCc2ccccc2)s1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O2S3/c16-11-6-7-12(17)13(8-11)25(21,22)20-14-18-19-15(24-14)23-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,18,20) |
| InChIKey | UEHFNDOSXFDUMI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |