C17H12ClF4N3 — CID 100560606
4-(2-chloro-6-fluorophenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-5-amine (PubChem CID 100560606) has the molecular formula C17H12ClF4N3 and a molecular weight of 369.75 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-5-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 100560606 |
| Molecular Formula | C17H12ClF4N3 |
| Molecular Weight | 369.75 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-1-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-5-amine |
| SMILES | Cc1ccc(-n2nc(C(F)(F)F)c(-c3c(F)cccc3Cl)c2N)cc1 |
| InChI | InChI=1S/C17H12ClF4N3/c1-9-5-7-10(8-6-9)25-16(23)14(15(24-25)17(20,21)22)13-11(18)3-2-4-12(13)19/h2-8H,23H2,1H3 |
| InChIKey | FIKMHJBAYOCITA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |