C18H13F6N3O — CID 100561144
4-(4-methoxyphenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 100561144) has the molecular formula C18H13F6N3O and a molecular weight of 401.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 4-(4-methoxyphenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 100561144 |
| Molecular Formula | C18H13F6N3O |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | COc1ccc(-c2c(C(F)(F)F)nn(-c3cccc(C(F)(F)F)c3)c2N)cc1 |
| InChI | InChI=1S/C18H13F6N3O/c1-28-13-7-5-10(6-8-13)14-15(18(22,23)24)26-27(16(14)25)12-4-2-3-11(9-12)17(19,20)21/h2-9H,25H2,1H3 |
| InChIKey | LBLCGYRUKMXEQW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |