C15H11F6N5 — CID 171789512
1-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 171789512) has the molecular formula C15H11F6N5 and a molecular weight of 375.28 g/mol. Its IUPAC name is 1-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 1-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 171789512 |
| Molecular Formula | C15H11F6N5 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | Cn1ccc(-n2nc(C(F)(F)F)c(-c3cccc(C(F)(F)F)c3)c2N)n1 |
| InChI | InChI=1S/C15H11F6N5/c1-25-6-5-10(23-25)26-13(22)11(12(24-26)15(19,20)21)8-3-2-4-9(7-8)14(16,17)18/h2-7H,22H2,1H3 |
| InChIKey | HXMMPKLPQKEBHC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |