C17H10BrF6N3 — CID 100560928
4-(3-bromophenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 100560928) has the molecular formula C17H10BrF6N3 and a molecular weight of 450.18 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 4-(3-bromophenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 100560928 |
| Molecular Formula | C17H10BrF6N3 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 4-(3-bromophenyl)-3-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | Nc1c(-c2cccc(Br)c2)c(C(F)(F)F)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10BrF6N3/c18-11-5-1-3-9(7-11)13-14(17(22,23)24)26-27(15(13)25)12-6-2-4-10(8-12)16(19,20)21/h1-8H,25H2 |
| InChIKey | UAAWWDYOHUWFKF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |