C21H12F6N2 — CID 21044944
1,3-bis[3-(trifluoromethyl)phenyl]indazole (PubChem CID 21044944) has the molecular formula C21H12F6N2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 1,3-bis[3-(trifluoromethyl)phenyl]indazole.
| Compound Name | 1,3-bis[3-(trifluoromethyl)phenyl]indazole |
|---|---|
| PubChem CID | 21044944 |
| Molecular Formula | C21H12F6N2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1,3-bis[3-(trifluoromethyl)phenyl]indazole |
| SMILES | FC(F)(F)c1cccc(-c2nn(-c3cccc(C(F)(F)F)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C21H12F6N2/c22-20(23,24)14-6-3-5-13(11-14)19-17-9-1-2-10-18(17)29(28-19)16-8-4-7-15(12-16)21(25,26)27/h1-12H |
| InChIKey | UQXLVTYZHPFZPT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |