C24H20F3N3O2 — CID 176747636
1-(oxan-4-yl)-4-[1-[4-(trifluoromethyl)phenyl]indazol-3-yl]pyridin-2-one (PubChem CID 176747636) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 1-(oxan-4-yl)-4-[1-[4-(trifluoromethyl)phenyl]indazol-3-yl]pyridin-2-one.
| Compound Name | 1-(oxan-4-yl)-4-[1-[4-(trifluoromethyl)phenyl]indazol-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 176747636 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-(oxan-4-yl)-4-[1-[4-(trifluoromethyl)phenyl]indazol-3-yl]pyridin-2-one |
| SMILES | O=c1cc(-c2nn(-c3ccc(C(F)(F)F)cc3)c3ccccc23)ccn1C1CCOCC1 |
| InChI | InChI=1S/C24H20F3N3O2/c25-24(26,27)17-5-7-19(8-6-17)30-21-4-2-1-3-20(21)23(28-30)16-9-12-29(22(31)15-16)18-10-13-32-14-11-18/h1-9,12,15,18H,10-11,13-14H2 |
| InChIKey | GGNYTQVRHUOCDD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |