C20H11F3N4O — CID 176747630
3-(2-oxo-1H-pyridin-4-yl)-1-[4-(trifluoromethyl)phenyl]indazole-7-carbonitrile (PubChem CID 176747630) has the molecular formula C20H11F3N4O and a molecular weight of 380.33 g/mol. Its IUPAC name is 3-(2-oxo-1H-pyridin-4-yl)-1-[4-(trifluoromethyl)phenyl]indazole-7-carbonitrile.
| Compound Name | 3-(2-oxo-1H-pyridin-4-yl)-1-[4-(trifluoromethyl)phenyl]indazole-7-carbonitrile |
|---|---|
| PubChem CID | 176747630 |
| Molecular Formula | C20H11F3N4O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-(2-oxo-1H-pyridin-4-yl)-1-[4-(trifluoromethyl)phenyl]indazole-7-carbonitrile |
| SMILES | N#Cc1cccc2c(-c3cc[nH]c(=O)c3)nn(-c3ccc(C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C20H11F3N4O/c21-20(22,23)14-4-6-15(7-5-14)27-19-13(11-24)2-1-3-16(19)18(26-27)12-8-9-25-17(28)10-12/h1-10H,(H,25,28) |
| InChIKey | JEKZQJQUXKCZLX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |