C20H17F3IN3 — CID 3933009
3-(3-iodophenyl)-1-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 3933009) has the molecular formula C20H17F3IN3 and a molecular weight of 483.28 g/mol. Its IUPAC name is 3-(3-iodophenyl)-1-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 3-(3-iodophenyl)-1-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 3933009 |
| Molecular Formula | C20H17F3IN3 |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 3-(3-iodophenyl)-1-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | FC(F)(F)c1ccc(-n2nc(-c3cccc(I)c3)c3c2NCCCC3)cc1 |
| InChI | InChI=1S/C20H17F3IN3/c21-20(22,23)14-7-9-16(10-8-14)27-19-17(6-1-2-11-25-19)18(26-27)13-4-3-5-15(24)12-13/h3-5,7-10,12,25H,1-2,6,11H2 |
| InChIKey | IHYPOOXWAHEFLD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|