C18H12ClF3IN3 — CID 5104450
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 5104450) has the molecular formula C18H12ClF3IN3 and a molecular weight of 489.67 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 5104450 |
| Molecular Formula | C18H12ClF3IN3 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | FC(F)(F)c1ccc(Cl)c(-n2nc(-c3cccc(I)c3)c3c2NCC3)c1 |
| InChI | InChI=1S/C18H12ClF3IN3/c19-14-5-4-11(18(20,21)22)9-15(14)26-17-13(6-7-24-17)16(25-26)10-2-1-3-12(23)8-10/h1-5,8-9,24H,6-7H2 |
| InChIKey | FAJOYCJRUHHHKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|