C31H38FN3O5S2 — CID 100561248
(2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 100561248) has the molecular formula C31H38FN3O5S2 and a molecular weight of 615.79 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100561248 |
| Molecular Formula | C31H38FN3O5S2 |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C31H38FN3O5S2/c1-5-7-20-33-31(37)23(3)34(21-24-10-8-9-11-29(24)32)30(36)22-35(25-12-14-26(15-13-25)40-6-2)42(38,39)28-18-16-27(41-4)17-19-28/h8-19,23H,5-7,20-22H2,1-4H3,(H,33,37)/t23-/m1/s1 |
| InChIKey | NNXCHNLFEAWZFD-HSZRJFAPSA-N |
| XLogP | 5.48 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|