C29H33ClFN3O5S — CID 133151617
N-butyl-2-[[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide (PubChem CID 133151617) has the molecular formula C29H33ClFN3O5S and a molecular weight of 590.12 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 133151617 |
| Molecular Formula | C29H33ClFN3O5S |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | N-butyl-2-[[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]-[(2-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1F)C(=O)CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H33ClFN3O5S/c1-4-5-18-32-29(36)21(2)33(19-22-8-6-7-9-27(22)31)28(35)20-34(24-12-10-23(30)11-13-24)40(37,38)26-16-14-25(39-3)15-17-26/h6-17,21H,4-5,18-20H2,1-3H3,(H,32,36) |
| InChIKey | HYPWTTPQZHCEAT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|