C16H20Cl2N4O3S3 — CID 100563373
(2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 100563373) has the molecular formula C16H20Cl2N4O3S3 and a molecular weight of 483.47 g/mol. Its IUPAC name is (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 100563373 |
| Molecular Formula | C16H20Cl2N4O3S3 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCCSc1nnc(NC(=O)[C@H](CC)N(c2cc(Cl)ccc2Cl)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H20Cl2N4O3S3/c1-4-8-26-16-21-20-15(27-16)19-14(23)12(5-2)22(28(3,24)25)13-9-10(17)6-7-11(13)18/h6-7,9,12H,4-5,8H2,1-3H3,(H,19,20,23)/t12-/m0/s1 |
| InChIKey | DUPQZTIGRBSVPK-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|