C22H26BrFN2O2 — CID 100572254
(2R)-2-[(3-bromophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-butylpropanamide (PubChem CID 100572254) has the molecular formula C22H26BrFN2O2 and a molecular weight of 449.36 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-butylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100572254 |
| Molecular Formula | C22H26BrFN2O2 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Br)c1)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26BrFN2O2/c1-3-4-12-25-22(28)16(2)26(15-18-6-5-7-19(23)13-18)21(27)14-17-8-10-20(24)11-9-17/h5-11,13,16H,3-4,12,14-15H2,1-2H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | YOBFLYGBWSVPAJ-MRXNPFEDSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|