C23H28BrClN2O2 — CID 133152030
2-[(3-bromophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]-N-butylpropanamide (PubChem CID 133152030) has the molecular formula C23H28BrClN2O2 and a molecular weight of 479.85 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152030 |
| Molecular Formula | C23H28BrClN2O2 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[3-(2-chlorophenyl)propanoyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C23H28BrClN2O2/c1-3-4-14-26-23(29)17(2)27(16-18-8-7-10-20(24)15-18)22(28)13-12-19-9-5-6-11-21(19)25/h5-11,15,17H,3-4,12-14,16H2,1-2H3,(H,26,29) |
| InChIKey | LLMCJDFUGNHSMI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|