C27H38BrN3O4S — CID 100576717
N-[(4-bromophenyl)methyl]-N-[(2R)-1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100576717) has the molecular formula C27H38BrN3O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-[(2R)-1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-[(2R)-1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100576717 |
| Molecular Formula | C27H38BrN3O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-[(2R)-1-(butylamino)-1-oxopropan-2-yl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1ccc(Br)cc1)C(=O)CCCN(c1ccc(C)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H38BrN3O4S/c1-6-7-16-29-27(33)22(4)30(19-23-11-13-24(28)14-12-23)26(32)9-8-17-31(36(5,34)35)25-15-10-20(2)21(3)18-25/h10-15,18,22H,6-9,16-17,19H2,1-5H3,(H,29,33)/t22-/m1/s1 |
| InChIKey | ZHCQRRDCZURNEC-JOCHJYFZSA-N |
| XLogP | 4.95 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|