C27H38ClN3O4S — CID 133151398
N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(3-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 133151398) has the molecular formula C27H38ClN3O4S and a molecular weight of 536.14 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(3-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(3-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133151398 |
| Molecular Formula | C27H38ClN3O4S |
| Molecular Weight | 536.14 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(3-chlorophenyl)methyl]-4-(3,4-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CCCN(c1ccc(C)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H38ClN3O4S/c1-6-7-15-29-27(33)22(4)30(19-23-10-8-11-24(28)18-23)26(32)12-9-16-31(36(5,34)35)25-14-13-20(2)21(3)17-25/h8,10-11,13-14,17-18,22H,6-7,9,12,15-16,19H2,1-5H3,(H,29,33) |
| InChIKey | IOKRXYMRXSOAOO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|