C25H33BrClN3O4S — CID 100571269
N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-chloro-N-methylsulfonylanilino)butanamide (PubChem CID 100571269) has the molecular formula C25H33BrClN3O4S and a molecular weight of 586.98 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-chloro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-chloro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100571269 |
| Molecular Formula | C25H33BrClN3O4S |
| Molecular Weight | 586.98 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-chloro-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CCCN(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H33BrClN3O4S/c1-4-5-14-28-25(32)19(2)29(18-20-9-6-10-21(26)16-20)24(31)13-8-15-30(35(3,33)34)23-12-7-11-22(27)17-23/h6-7,9-12,16-17,19H,4-5,8,13-15,18H2,1-3H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | NYGWUZGEIUOBIG-IBGZPJMESA-N |
| XLogP | 4.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.98 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|