C26H36BrN3O5S — CID 100571512
N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100571512) has the molecular formula C26H36BrN3O5S and a molecular weight of 582.56 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100571512 |
| Molecular Formula | C26H36BrN3O5S |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[(2S)-1-(butylamino)-1-oxopropan-2-yl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Br)c1)C(=O)CCCN(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C26H36BrN3O5S/c1-5-6-15-28-26(32)20(2)29(19-21-10-7-11-22(27)17-21)25(31)14-9-16-30(36(4,33)34)23-12-8-13-24(18-23)35-3/h7-8,10-13,17-18,20H,5-6,9,14-16,19H2,1-4H3,(H,28,32)/t20-/m0/s1 |
| InChIKey | KXCZBFUJLQMNLH-FQEVSTJZSA-N |
| XLogP | 4.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|