C26H36BrN3O4S — CID 133152021
N-[(3-bromophenyl)methyl]-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)butanamide (PubChem CID 133152021) has the molecular formula C26H36BrN3O4S and a molecular weight of 566.56 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 133152021 |
| Molecular Formula | C26H36BrN3O4S |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[1-(butylamino)-1-oxopropan-2-yl]-4-(4-methyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)CCCN(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H36BrN3O4S/c1-5-6-16-28-26(32)21(3)29(19-22-9-7-10-23(27)18-22)25(31)11-8-17-30(35(4,33)34)24-14-12-20(2)13-15-24/h7,9-10,12-15,18,21H,5-6,8,11,16-17,19H2,1-4H3,(H,28,32) |
| InChIKey | FPSUPUXRDJGFPR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|